C7H8F6O — CID 54352074
3-ethenoxy-1,1,2,2,5,5-hexafluoropentane (PubChem CID 54352074) has the molecular formula C7H8F6O and a molecular weight of 222.13 g/mol. Its IUPAC name is 3-ethenoxy-1,1,2,2,5,5-hexafluoropentane.
| Compound Name | 3-ethenoxy-1,1,2,2,5,5-hexafluoropentane |
|---|---|
| PubChem CID | 54352074 |
| Molecular Formula | C7H8F6O |
| Molecular Weight | 222.13 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | 3-ethenoxy-1,1,2,2,5,5-hexafluoropentane |
| SMILES | C=COC(CC(F)F)C(F)(F)C(F)F |
| InChI | InChI=1S/C7H8F6O/c1-2-14-4(3-5(8)9)7(12,13)6(10)11/h2,4-6H,1,3H2 |
| InChIKey | UGLXVSVYHFQPQN-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.13 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|