C4H4F6O3S — CID 87438689
1-ethenoxy-1,1,2,2-tetrafluoroethane;sulfuryl difluoride (PubChem CID 87438689) has the molecular formula C4H4F6O3S and a molecular weight of 246.13 g/mol. Its IUPAC name is 1-ethenoxy-1,1,2,2-tetrafluoroethane;sulfuryl difluoride.
| Compound Name | 1-ethenoxy-1,1,2,2-tetrafluoroethane;sulfuryl difluoride |
|---|---|
| PubChem CID | 87438689 |
| Molecular Formula | C4H4F6O3S |
| Molecular Weight | 246.13 g/mol |
| Exact Mass | 245.98 |
| IUPAC Name | 1-ethenoxy-1,1,2,2-tetrafluoroethane;sulfuryl difluoride |
| SMILES | C=COC(F)(F)C(F)F.O=S(=O)(F)F |
| InChI | InChI=1S/C4H4F4O.F2O2S/c1-2-9-4(7,8)3(5)6;1-5(2,3)4/h2-3H,1H2; |
| InChIKey | IGALUJILDUPTBU-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.13 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|