About 3-ethenoxypenta-1,4-diene
3-ethenoxypenta-1,4-diene (PubChem CID 14223809) has the molecular formula C7H10O
and a molecular weight of 110.16 g/mol. Its IUPAC name is 3-ethenoxypenta-1,4-diene.
Molecular Properties
| Compound Name | 3-ethenoxypenta-1,4-diene |
| PubChem CID | 14223809 |
| Molecular Formula | C7H10O |
| Molecular Weight | 110.16 g/mol |
| Exact Mass | 110.07 |
| IUPAC Name | 3-ethenoxypenta-1,4-diene |
| SMILES | C=COC(C=C)C=C |
| InChI | InChI=1S/C7H10O/c1-4-7(5-2)8-6-3/h4-7H,1-3H2 |
| InChIKey | BNFXMNDCFBGIES-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.16 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-ethenoxypenta-1,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenoxypenta-1,4-diene?
The IUPAC name of 3-ethenoxypenta-1,4-diene (CID 14223809) is 3-ethenoxypenta-1,4-diene.
What is the SMILES notation for 3-ethenoxypenta-1,4-diene?
The canonical SMILES for 3-ethenoxypenta-1,4-diene is C=COC(C=C)C=C.
What is the InChIKey of 3-ethenoxypenta-1,4-diene?
The InChIKey is BNFXMNDCFBGIES-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O/c1-4-7(5-2)8-6-3/h4-7H,1-3H2.
What are the key properties of 3-ethenoxypenta-1,4-diene?
3-ethenoxypenta-1,4-diene has a molecular weight of 110.16 g/mol, XLogP of 1.89, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenoxypenta-1,4-diene is sourced from PubChem (CID 14223809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).