C13H17NO6S — CID 175353725
cyclohex-3-en-1-ylmethanol;2-nitrobenzenesulfonic acid (PubChem CID 175353725) has the molecular formula C13H17NO6S and a molecular weight of 315.35 g/mol. Its IUPAC name is cyclohex-3-en-1-ylmethanol;2-nitrobenzenesulfonic acid.
| Compound Name | cyclohex-3-en-1-ylmethanol;2-nitrobenzenesulfonic acid |
|---|---|
| PubChem CID | 175353725 |
| Molecular Formula | C13H17NO6S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | cyclohex-3-en-1-ylmethanol;2-nitrobenzenesulfonic acid |
| SMILES | O=[N+]([O-])c1ccccc1S(=O)(=O)O.OCC1CC=CCC1 |
| InChI | InChI=1S/C7H12O.C6H5NO5S/c8-6-7-4-2-1-3-5-7;8-7(9)5-3-1-2-4-6(5)13(10,11)12/h1-2,7-8H,3-6H2;1-4H,(H,10,11,12) |
| InChIKey | GIRDMYLGIRPVIV-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 117.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|