C7H10F6O5 — CID 175354998
ethane-1,2-diol;prop-2-enoic acid;trifluoro(trifluoromethoxy)methane (PubChem CID 175354998) has the molecular formula C7H10F6O5 and a molecular weight of 288.14 g/mol. Its IUPAC name is ethane-1,2-diol;prop-2-enoic acid;trifluoro(trifluoromethoxy)methane.
| Compound Name | ethane-1,2-diol;prop-2-enoic acid;trifluoro(trifluoromethoxy)methane |
|---|---|
| PubChem CID | 175354998 |
| Molecular Formula | C7H10F6O5 |
| Molecular Weight | 288.14 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | ethane-1,2-diol;prop-2-enoic acid;trifluoro(trifluoromethoxy)methane |
| SMILES | C=CC(=O)O.FC(F)(F)OC(F)(F)F.OCCO |
| InChI | InChI=1S/C3H4O2.C2F6O.C2H6O2/c1-2-3(4)5;3-1(4,5)9-2(6,7)8;3-1-2-4/h2H,1H2,(H,4,5);;3-4H,1-2H2 |
| InChIKey | ZEMIGAQMZBNWJB-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.14 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|