C9H12O4S — CID 175355386
2,3-dihydrothieno[3,4-b][1,4]dioxine;methyl acetate (PubChem CID 175355386) has the molecular formula C9H12O4S and a molecular weight of 216.26 g/mol. Its IUPAC name is 2,3-dihydrothieno[3,4-b][1,4]dioxine;methyl acetate.
| Compound Name | 2,3-dihydrothieno[3,4-b][1,4]dioxine;methyl acetate |
|---|---|
| PubChem CID | 175355386 |
| Molecular Formula | C9H12O4S |
| Molecular Weight | 216.26 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | 2,3-dihydrothieno[3,4-b][1,4]dioxine;methyl acetate |
| SMILES | COC(C)=O.c1scc2c1OCCO2 |
| InChI | InChI=1S/C6H6O2S.C3H6O2/c1-2-8-6-4-9-3-5(6)7-1;1-3(4)5-2/h3-4H,1-2H2;1-2H3 |
| InChIKey | XNTNFJNRTCKPSH-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.26 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |