C18H19N3O3 — CID 175356691
6-benzyl-2-N-methyl-2-N-(oxetan-3-yl)pyridine-2,4-dicarboxamide (PubChem CID 175356691) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is 6-benzyl-2-N-methyl-2-N-(oxetan-3-yl)pyridine-2,4-dicarboxamide.
| Compound Name | 6-benzyl-2-N-methyl-2-N-(oxetan-3-yl)pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 175356691 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 6-benzyl-2-N-methyl-2-N-(oxetan-3-yl)pyridine-2,4-dicarboxamide |
| SMILES | CN(C(=O)c1cc(C(N)=O)cc(Cc2ccccc2)n1)C1COC1 |
| InChI | InChI=1S/C18H19N3O3/c1-21(15-10-24-11-15)18(23)16-9-13(17(19)22)8-14(20-16)7-12-5-3-2-4-6-12/h2-6,8-9,15H,7,10-11H2,1H3,(H2,19,22) |
| InChIKey | PCAVAJHKMUGBIZ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |