C19H19BrF2N2O4S — CID 175358534
3-bromo-4-[2-[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]ethyl]benzoic acid (PubChem CID 175358534) has the molecular formula C19H19BrF2N2O4S and a molecular weight of 489.34 g/mol. Its IUPAC name is 3-bromo-4-[2-[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]ethyl]benzoic acid.
| Compound Name | 3-bromo-4-[2-[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 175358534 |
| Molecular Formula | C19H19BrF2N2O4S |
| Molecular Weight | 489.34 g/mol |
| Exact Mass | 488.02 |
| IUPAC Name | 3-bromo-4-[2-[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]ethyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CCN2CCN(S(=O)(=O)c3c(F)cccc3F)CC2)c(Br)c1 |
| InChI | InChI=1S/C19H19BrF2N2O4S/c20-15-12-14(19(25)26)5-4-13(15)6-7-23-8-10-24(11-9-23)29(27,28)18-16(21)2-1-3-17(18)22/h1-5,12H,6-11H2,(H,25,26) |
| InChIKey | HLAPCDPWVBRHJO-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |