C30H31N5O8S4 — CID 175359559
2-[[4-[(2-amino-2-hydroxyethyl)-[4-(2-isothiocyanatoethylsulfanyloxy)phenyl]sulfonylamino]naphthalen-1-yl]-(4-methoxyphenyl)sulfonylamino]acetamide (PubChem CID 175359559) has the molecular formula C30H31N5O8S4 and a molecular weight of 717.87 g/mol. Its IUPAC name is 2-[[4-[(2-amino-2-hydroxyethyl)-[4-(2-isothiocyanatoethylsulfanyloxy)phenyl]sulfonylamino]naphthalen-1-yl]-(4-methoxyphenyl)sulfonylamino]acetamide.
| Compound Name | 2-[[4-[(2-amino-2-hydroxyethyl)-[4-(2-isothiocyanatoethylsulfanyloxy)phenyl]sulfonylamino]naphthalen-1-yl]-(4-methoxyphenyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 175359559 |
| Molecular Formula | C30H31N5O8S4 |
| Molecular Weight | 717.87 g/mol |
| Exact Mass | 717.11 |
| IUPAC Name | 2-[[4-[(2-amino-2-hydroxyethyl)-[4-(2-isothiocyanatoethylsulfanyloxy)phenyl]sulfonylamino]naphthalen-1-yl]-(4-methoxyphenyl)sulfonylamino]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(N)=O)c2ccc(N(CC(N)O)S(=O)(=O)c3ccc(OSCCN=C=S)cc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C30H31N5O8S4/c1-42-21-6-10-23(11-7-21)46(38,39)34(18-29(31)36)27-14-15-28(26-5-3-2-4-25(26)27)35(19-30(32)37)47(40,41)24-12-8-22(9-13-24)43-45-17-16-33-20-44/h2-15,30,37H,16-19,32H2,1H3,(H2,31,36) |
| InChIKey | SRJMYVXCLRIZKB-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 194.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.87 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|