C34H37N5O9S4 — CID 164615618
2-[[4-[(2-amino-2-oxoethyl)-[4-[2-[2-(2-isothiocyanatoethoxy)ethoxy]ethylsulfanyl]phenyl]sulfonylamino]naphthalen-1-yl]-(4-methoxyphenyl)sulfonylamino]acetamide (PubChem CID 164615618) has the molecular formula C34H37N5O9S4 and a molecular weight of 787.96 g/mol. Its IUPAC name is 2-[[4-[(2-amino-2-oxoethyl)-[4-[2-[2-(2-isothiocyanatoethoxy)ethoxy]ethylsulfanyl]phenyl]sulfonylamino]naphthalen-1-yl]-(4-methoxyphenyl)sulfonylamino]acetamide.
| Compound Name | 2-[[4-[(2-amino-2-oxoethyl)-[4-[2-[2-(2-isothiocyanatoethoxy)ethoxy]ethylsulfanyl]phenyl]sulfonylamino]naphthalen-1-yl]-(4-methoxyphenyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 164615618 |
| Molecular Formula | C34H37N5O9S4 |
| Molecular Weight | 787.96 g/mol |
| Exact Mass | 787.15 |
| IUPAC Name | 2-[[4-[(2-amino-2-oxoethyl)-[4-[2-[2-(2-isothiocyanatoethoxy)ethoxy]ethylsulfanyl]phenyl]sulfonylamino]naphthalen-1-yl]-(4-methoxyphenyl)sulfonylamino]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(N)=O)c2ccc(N(CC(N)=O)S(=O)(=O)c3ccc(SCCOCCOCCN=C=S)cc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C34H37N5O9S4/c1-46-25-6-10-27(11-7-25)51(42,43)38(22-33(35)40)31-14-15-32(30-5-3-2-4-29(30)31)39(23-34(36)41)52(44,45)28-12-8-26(9-13-28)50-21-20-48-19-18-47-17-16-37-24-49/h2-15H,16-23H2,1H3,(H2,35,40)(H2,36,41) |
| InChIKey | IOFWMVMAYGNGOQ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 200.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.96 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|