C21H25N3O5 — CID 175361503
5-acetamido-N-[(3-hydroxy-4-methoxyphenyl)methyl]-2-morpholin-2-ylbenzamide (PubChem CID 175361503) has the molecular formula C21H25N3O5 and a molecular weight of 399.45 g/mol. Its IUPAC name is 5-acetamido-N-[(3-hydroxy-4-methoxyphenyl)methyl]-2-morpholin-2-ylbenzamide.
| Compound Name | 5-acetamido-N-[(3-hydroxy-4-methoxyphenyl)methyl]-2-morpholin-2-ylbenzamide |
|---|---|
| PubChem CID | 175361503 |
| Molecular Formula | C21H25N3O5 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | 5-acetamido-N-[(3-hydroxy-4-methoxyphenyl)methyl]-2-morpholin-2-ylbenzamide |
| SMILES | COc1ccc(CNC(=O)c2cc(NC(C)=O)ccc2C2CNCCO2)cc1O |
| InChI | InChI=1S/C21H25N3O5/c1-13(25)24-15-4-5-16(20-12-22-7-8-29-20)17(10-15)21(27)23-11-14-3-6-19(28-2)18(26)9-14/h3-6,9-10,20,22,26H,7-8,11-12H2,1-2H3,(H,23,27)(H,24,25) |
| InChIKey | OQWKOCDKGSRABZ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |