C25H23N3O — CID 175361903
2-[3-[2-[4-(dimethylamino)phenyl]ethenyl]-5-methyl-4-(2H-pyran-2-yl)cyclohexa-2,4-dien-1-ylidene]propanedinitrile (PubChem CID 175361903) has the molecular formula C25H23N3O and a molecular weight of 381.48 g/mol. Its IUPAC name is 2-[3-[2-[4-(dimethylamino)phenyl]ethenyl]-5-methyl-4-(2H-pyran-2-yl)cyclohexa-2,4-dien-1-ylidene]propanedinitrile.
| Compound Name | 2-[3-[2-[4-(dimethylamino)phenyl]ethenyl]-5-methyl-4-(2H-pyran-2-yl)cyclohexa-2,4-dien-1-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 175361903 |
| Molecular Formula | C25H23N3O |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 2-[3-[2-[4-(dimethylamino)phenyl]ethenyl]-5-methyl-4-(2H-pyran-2-yl)cyclohexa-2,4-dien-1-ylidene]propanedinitrile |
| SMILES | CC1=C(C2C=CC=CO2)C(C=Cc2ccc(N(C)C)cc2)=CC(=C(C#N)C#N)C1 |
| InChI | InChI=1S/C25H23N3O/c1-18-14-21(22(16-26)17-27)15-20(25(18)24-6-4-5-13-29-24)10-7-19-8-11-23(12-9-19)28(2)3/h4-13,15,24H,14H2,1-3H3 |
| InChIKey | AHGYIWWZOJQFCF-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 60.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|