C18H23N — CID 23583812
4-[(E)-2-(4,5-dimethylcyclohexa-1,4-dien-1-yl)ethenyl]-N,N-dimethylaniline (PubChem CID 23583812) has the molecular formula C18H23N and a molecular weight of 253.39 g/mol. Its IUPAC name is 4-[(E)-2-(4,5-dimethylcyclohexa-1,4-dien-1-yl)ethenyl]-N,N-dimethylaniline.
| Compound Name | 4-[(E)-2-(4,5-dimethylcyclohexa-1,4-dien-1-yl)ethenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 23583812 |
| Molecular Formula | C18H23N |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 4-[(E)-2-(4,5-dimethylcyclohexa-1,4-dien-1-yl)ethenyl]-N,N-dimethylaniline |
| SMILES | CC1=C(C)CC(/C=C/c2ccc(N(C)C)cc2)=CC1 |
| InChI | InChI=1S/C18H23N/c1-14-5-6-17(13-15(14)2)8-7-16-9-11-18(12-10-16)19(3)4/h6-12H,5,13H2,1-4H3/b8-7+ |
| InChIKey | JKCGXXIWELRNDU-BQYQJAHWSA-N |
| XLogP | 4.82 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|