About decan-5-yl-hydroxy-oxophosphanium;hydroxy-octan-3-yl-oxophosphanium
decan-5-yl-hydroxy-oxophosphanium;hydroxy-octan-3-yl-oxophosphanium (PubChem CID 175364038) has the molecular formula C18H40O4P2+2
and a molecular weight of 382.46 g/mol. Its IUPAC name is decan-5-yl-hydroxy-oxophosphanium;hydroxy-octan-3-yl-oxophosphanium.
Molecular Properties
| Compound Name | decan-5-yl-hydroxy-oxophosphanium;hydroxy-octan-3-yl-oxophosphanium |
| PubChem CID | 175364038 |
| Molecular Formula | C18H40O4P2+2 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | decan-5-yl-hydroxy-oxophosphanium;hydroxy-octan-3-yl-oxophosphanium |
| SMILES | CCCCCC(CC)[P+](=O)O.CCCCCC(CCCC)[P+](=O)O |
| InChI | InChI=1S/C10H21O2P.C8H17O2P/c1-3-5-7-9-10(13(11)12)8-6-4-2;1-3-5-6-7-8(4-2)11(9)10/h10H,3-9H2,1-2H3;8H,3-7H2,1-2H3/p+2 |
| InChIKey | RNFILCWERAKEAX-UHFFFAOYSA-P |
| XLogP | 6.94 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze decan-5-yl-hydroxy-oxophosphanium;hydroxy-octan-3-yl-oxophosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decan-5-yl-hydroxy-oxophosphanium;hydroxy-octan-3-yl-oxophosphanium?
The IUPAC name of decan-5-yl-hydroxy-oxophosphanium;hydroxy-octan-3-yl-oxophosphanium (CID 175364038) is decan-5-yl-hydroxy-oxophosphanium;hydroxy-octan-3-yl-oxophosphanium.
What is the SMILES notation for decan-5-yl-hydroxy-oxophosphanium;hydroxy-octan-3-yl-oxophosphanium?
The canonical SMILES for decan-5-yl-hydroxy-oxophosphanium;hydroxy-octan-3-yl-oxophosphanium is CCCCCC(CC)[P+](=O)O.CCCCCC(CCCC)[P+](=O)O.
What is the InChIKey of decan-5-yl-hydroxy-oxophosphanium;hydroxy-octan-3-yl-oxophosphanium?
The InChIKey is RNFILCWERAKEAX-UHFFFAOYSA-P. The full InChI is InChI=1S/C10H21O2P.C8H17O2P/c1-3-5-7-9-10(13(11)12)8-6-4-2;1-3-5-6-7-8(4-2)11(9)10/h10H,3-9H2,1-2H3;8H,3-7H2,1-2H3/p+2.
What are the key properties of decan-5-yl-hydroxy-oxophosphanium;hydroxy-octan-3-yl-oxophosphanium?
decan-5-yl-hydroxy-oxophosphanium;hydroxy-octan-3-yl-oxophosphanium has a molecular weight of 382.46 g/mol, XLogP of 6.94, 14 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for decan-5-yl-hydroxy-oxophosphanium;hydroxy-octan-3-yl-oxophosphanium is sourced from PubChem (CID 175364038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).