C21H34O2 — CID 175365913
2-[(8S,9S,10R,13R,14S,17R)-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-3H-cyclopenta[a]phenanthren-17-yl]ethane-1,1-diol (PubChem CID 175365913) has the molecular formula C21H34O2 and a molecular weight of 318.50 g/mol. Its IUPAC name is 2-[(8S,9S,10R,13R,14S,17R)-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-3H-cyclopenta[a]phenanthren-17-yl]ethane-1,1-diol.
| Compound Name | 2-[(8S,9S,10R,13R,14S,17R)-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-3H-cyclopenta[a]phenanthren-17-yl]ethane-1,1-diol |
|---|---|
| PubChem CID | 175365913 |
| Molecular Formula | C21H34O2 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.26 |
| IUPAC Name | 2-[(8S,9S,10R,13R,14S,17R)-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-3H-cyclopenta[a]phenanthren-17-yl]ethane-1,1-diol |
| SMILES | C[C@]12CC[C@H]3[C@@H](CCC4CCC=C[C@@]43C)[C@@H]1CC[C@@H]2CC(O)O |
| InChI | InChI=1S/C21H34O2/c1-20-11-4-3-5-14(20)6-8-16-17-9-7-15(13-19(22)23)21(17,2)12-10-18(16)20/h4,11,14-19,22-23H,3,5-10,12-13H2,1-2H3/t14?,15-,16+,17+,18+,20+,21-/m1/s1 |
| InChIKey | YQJVLXMSHWZFSH-DIKHCDEOSA-N |
| XLogP | 4.51 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|