C26H34N2 — CID 90778949
1-[(8R,9R,10R,13S,14S)-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-3H-cyclopenta[a]phenanthren-17-yl]indazole (PubChem CID 90778949) has the molecular formula C26H34N2 and a molecular weight of 374.57 g/mol. Its IUPAC name is 1-[(8R,9R,10R,13S,14S)-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-3H-cyclopenta[a]phenanthren-17-yl]indazole.
| Compound Name | 1-[(8R,9R,10R,13S,14S)-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-3H-cyclopenta[a]phenanthren-17-yl]indazole |
|---|---|
| PubChem CID | 90778949 |
| Molecular Formula | C26H34N2 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.27 |
| IUPAC Name | 1-[(8R,9R,10R,13S,14S)-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-3H-cyclopenta[a]phenanthren-17-yl]indazole |
| SMILES | C[C@]12C=CCCC1CC[C@@H]1[C@H]2CC[C@]2(C)C(n3ncc4ccccc43)CC[C@@H]12 |
| InChI | InChI=1S/C26H34N2/c1-25-15-6-5-8-19(25)10-11-20-21-12-13-24(26(21,2)16-14-22(20)25)28-23-9-4-3-7-18(23)17-27-28/h3-4,6-7,9,15,17,19-22,24H,5,8,10-14,16H2,1-2H3/t19?,20-,21-,22+,24?,25-,26-/m0/s1 |
| InChIKey | TWTYCBWZJIQFCI-YATYIZLYSA-N |
| XLogP | 6.79 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|