C22H32N2 — CID 68933676
2-[(8S,9S,10R,13R,14S)-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-3H-cyclopenta[a]phenanthren-16-yl]-1H-imidazole (PubChem CID 68933676) has the molecular formula C22H32N2 and a molecular weight of 324.51 g/mol. Its IUPAC name is 2-[(8S,9S,10R,13R,14S)-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-3H-cyclopenta[a]phenanthren-16-yl]-1H-imidazole.
| Compound Name | 2-[(8S,9S,10R,13R,14S)-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-3H-cyclopenta[a]phenanthren-16-yl]-1H-imidazole |
|---|---|
| PubChem CID | 68933676 |
| Molecular Formula | C22H32N2 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.26 |
| IUPAC Name | 2-[(8S,9S,10R,13R,14S)-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-3H-cyclopenta[a]phenanthren-16-yl]-1H-imidazole |
| SMILES | C[C@]12CC[C@H]3[C@@H](CCC4CCC=C[C@@]43C)[C@@H]1CC(c1ncc[nH]1)C2 |
| InChI | InChI=1S/C22H32N2/c1-21-10-8-18-17(7-6-16-5-3-4-9-22(16,18)2)19(21)13-15(14-21)20-23-11-12-24-20/h4,9,11-12,15-19H,3,5-8,10,13-14H2,1-2H3,(H,23,24)/t15?,16?,17-,18+,19+,21-,22+/m1/s1 |
| InChIKey | JTKKYJIQWKLSMP-OUBWFRRPSA-N |
| XLogP | 5.70 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|