C22H16ClN3O3 — CID 175374643
2-[[3-(2-chloro-3-phenylanilino)-1,2-benzoxazol-5-yl]methylideneamino]acetic acid (PubChem CID 175374643) has the molecular formula C22H16ClN3O3 and a molecular weight of 405.84 g/mol. Its IUPAC name is 2-[[3-(2-chloro-3-phenylanilino)-1,2-benzoxazol-5-yl]methylideneamino]acetic acid.
| Compound Name | 2-[[3-(2-chloro-3-phenylanilino)-1,2-benzoxazol-5-yl]methylideneamino]acetic acid |
|---|---|
| PubChem CID | 175374643 |
| Molecular Formula | C22H16ClN3O3 |
| Molecular Weight | 405.84 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | 2-[[3-(2-chloro-3-phenylanilino)-1,2-benzoxazol-5-yl]methylideneamino]acetic acid |
| SMILES | O=C(O)C/N=C/c1ccc2onc(Nc3cccc(-c4ccccc4)c3Cl)c2c1 |
| InChI | InChI=1S/C22H16ClN3O3/c23-21-16(15-5-2-1-3-6-15)7-4-8-18(21)25-22-17-11-14(12-24-13-20(27)28)9-10-19(17)29-26-22/h1-12H,13H2,(H,25,26)(H,27,28)/b24-12+ |
| InChIKey | OSWMRMVYUQMTEZ-WYMPLXKRSA-N |
| XLogP | 5.40 |
| TPSA | 87.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.84 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|