C25H22ClFN4O2 — CID 175375882
4-(3-chloro-2-fluoroanilino)-7-methoxy-6-(1-prop-2-enoylpiperidin-4-yl)quinoline-3-carbonitrile (PubChem CID 175375882) has the molecular formula C25H22ClFN4O2 and a molecular weight of 464.93 g/mol. Its IUPAC name is 4-(3-chloro-2-fluoroanilino)-7-methoxy-6-(1-prop-2-enoylpiperidin-4-yl)quinoline-3-carbonitrile.
| Compound Name | 4-(3-chloro-2-fluoroanilino)-7-methoxy-6-(1-prop-2-enoylpiperidin-4-yl)quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 175375882 |
| Molecular Formula | C25H22ClFN4O2 |
| Molecular Weight | 464.93 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | 4-(3-chloro-2-fluoroanilino)-7-methoxy-6-(1-prop-2-enoylpiperidin-4-yl)quinoline-3-carbonitrile |
| SMILES | C=CC(=O)N1CCC(c2cc3c(Nc4cccc(Cl)c4F)c(C#N)cnc3cc2OC)CC1 |
| InChI | InChI=1S/C25H22ClFN4O2/c1-3-23(32)31-9-7-15(8-10-31)17-11-18-21(12-22(17)33-2)29-14-16(13-28)25(18)30-20-6-4-5-19(26)24(20)27/h3-6,11-12,14-15H,1,7-10H2,2H3,(H,29,30) |
| InChIKey | UDIHZVPVIBDIAW-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.93 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|