C18H25N3O4 — CID 175377227
2-aminopropanoic acid;2-(methylamino)-3-[3-(2H-pyridin-1-yl)phenyl]propanoic acid (PubChem CID 175377227) has the molecular formula C18H25N3O4 and a molecular weight of 347.42 g/mol. Its IUPAC name is 2-aminopropanoic acid;2-(methylamino)-3-[3-(2H-pyridin-1-yl)phenyl]propanoic acid.
| Compound Name | 2-aminopropanoic acid;2-(methylamino)-3-[3-(2H-pyridin-1-yl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 175377227 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | 2-aminopropanoic acid;2-(methylamino)-3-[3-(2H-pyridin-1-yl)phenyl]propanoic acid |
| SMILES | CC(N)C(=O)O.CNC(Cc1cccc(N2C=CC=CC2)c1)C(=O)O |
| InChI | InChI=1S/C15H18N2O2.C3H7NO2/c1-16-14(15(18)19)11-12-6-5-7-13(10-12)17-8-3-2-4-9-17;1-2(4)3(5)6/h2-8,10,14,16H,9,11H2,1H3,(H,18,19);2H,4H2,1H3,(H,5,6) |
| InChIKey | XCBZDVUNHPKSBV-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |