C9H8FNO3S — CID 175380364
(5-fluorothiophen-2-yl)carbamoyl cyclopropanecarboxylate (PubChem CID 175380364) has the molecular formula C9H8FNO3S and a molecular weight of 229.23 g/mol. Its IUPAC name is (5-fluorothiophen-2-yl)carbamoyl cyclopropanecarboxylate.
| Compound Name | (5-fluorothiophen-2-yl)carbamoyl cyclopropanecarboxylate |
|---|---|
| PubChem CID | 175380364 |
| Molecular Formula | C9H8FNO3S |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.02 |
| IUPAC Name | (5-fluorothiophen-2-yl)carbamoyl cyclopropanecarboxylate |
| SMILES | O=C(Nc1ccc(F)s1)OC(=O)C1CC1 |
| InChI | InChI=1S/C9H8FNO3S/c10-6-3-4-7(15-6)11-9(13)14-8(12)5-1-2-5/h3-5H,1-2H2,(H,11,13) |
| InChIKey | UOIUJHGULXPQFH-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|