C12H9BrF3NO3 — CID 174811130
[5-bromo-2-(trifluoromethyl)phenyl]carbamoyl cyclopropanecarboxylate (PubChem CID 174811130) has the molecular formula C12H9BrF3NO3 and a molecular weight of 352.11 g/mol. Its IUPAC name is [5-bromo-2-(trifluoromethyl)phenyl]carbamoyl cyclopropanecarboxylate.
| Compound Name | [5-bromo-2-(trifluoromethyl)phenyl]carbamoyl cyclopropanecarboxylate |
|---|---|
| PubChem CID | 174811130 |
| Molecular Formula | C12H9BrF3NO3 |
| Molecular Weight | 352.11 g/mol |
| Exact Mass | 350.97 |
| IUPAC Name | [5-bromo-2-(trifluoromethyl)phenyl]carbamoyl cyclopropanecarboxylate |
| SMILES | O=C(Nc1cc(Br)ccc1C(F)(F)F)OC(=O)C1CC1 |
| InChI | InChI=1S/C12H9BrF3NO3/c13-7-3-4-8(12(14,15)16)9(5-7)17-11(19)20-10(18)6-1-2-6/h3-6H,1-2H2,(H,17,19) |
| InChIKey | KSNIURINRYZKNN-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.11 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|