C30H52N2O — CID 175384942
(Z)-N-[1-[2-(2-aminopropan-2-yl)phenyl]propyl]octadec-9-enamide (PubChem CID 175384942) has the molecular formula C30H52N2O and a molecular weight of 456.76 g/mol. Its IUPAC name is (Z)-N-[1-[2-(2-aminopropan-2-yl)phenyl]propyl]octadec-9-enamide.
| Compound Name | (Z)-N-[1-[2-(2-aminopropan-2-yl)phenyl]propyl]octadec-9-enamide |
|---|---|
| PubChem CID | 175384942 |
| Molecular Formula | C30H52N2O |
| Molecular Weight | 456.76 g/mol |
| Exact Mass | 456.41 |
| IUPAC Name | (Z)-N-[1-[2-(2-aminopropan-2-yl)phenyl]propyl]octadec-9-enamide |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)NC(CC)c1ccccc1C(C)(C)N |
| InChI | InChI=1S/C30H52N2O/c1-5-7-8-9-10-11-12-13-14-15-16-17-18-19-20-25-29(33)32-28(6-2)26-23-21-22-24-27(26)30(3,4)31/h13-14,21-24,28H,5-12,15-20,25,31H2,1-4H3,(H,32,33)/b14-13- |
| InChIKey | CZURYOVWMSFRER-YPKPFQOOSA-N |
| XLogP | 8.49 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.76 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|