C16H33N3O2 — CID 175384994
1,5-diamino-3-(11-aminoundecyl)pentane-2,4-dione (PubChem CID 175384994) has the molecular formula C16H33N3O2 and a molecular weight of 299.46 g/mol. Its IUPAC name is 1,5-diamino-3-(11-aminoundecyl)pentane-2,4-dione.
| Compound Name | 1,5-diamino-3-(11-aminoundecyl)pentane-2,4-dione |
|---|---|
| PubChem CID | 175384994 |
| Molecular Formula | C16H33N3O2 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.26 |
| IUPAC Name | 1,5-diamino-3-(11-aminoundecyl)pentane-2,4-dione |
| SMILES | NCCCCCCCCCCCC(C(=O)CN)C(=O)CN |
| InChI | InChI=1S/C16H33N3O2/c17-11-9-7-5-3-1-2-4-6-8-10-14(15(20)12-18)16(21)13-19/h14H,1-13,17-19H2 |
| InChIKey | CVKZFSNBKMWSSA-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 112.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|