C19H31NO3 — CID 175386643
2-aminoethyl 3-(3,5-dibutyl-4-hydroxyphenyl)propanoate (PubChem CID 175386643) has the molecular formula C19H31NO3 and a molecular weight of 321.46 g/mol. Its IUPAC name is 2-aminoethyl 3-(3,5-dibutyl-4-hydroxyphenyl)propanoate.
| Compound Name | 2-aminoethyl 3-(3,5-dibutyl-4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 175386643 |
| Molecular Formula | C19H31NO3 |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.23 |
| IUPAC Name | 2-aminoethyl 3-(3,5-dibutyl-4-hydroxyphenyl)propanoate |
| SMILES | CCCCc1cc(CCC(=O)OCCN)cc(CCCC)c1O |
| InChI | InChI=1S/C19H31NO3/c1-3-5-7-16-13-15(9-10-18(21)23-12-11-20)14-17(19(16)22)8-6-4-2/h13-14,22H,3-12,20H2,1-2H3 |
| InChIKey | ANPZFDKJXOFNIR-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |