C21H30NO7S- — CID 175392994
CID 175392994 (PubChem CID 175392994) has the molecular formula C21H30NO7S- and a molecular weight of 440.54 g/mol.
| Compound Name | CID 175392994 |
|---|---|
| PubChem CID | 175392994 |
| Molecular Formula | C21H30NO7S- |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | — |
| SMILES | COc1ccc(CC(CCO)Cc2ccc(OC)cc2OC)c(OC)c1.NS(=O)[O-] |
| InChI | InChI=1S/C21H28O5.H3NO2S/c1-23-18-7-5-16(20(13-18)25-3)11-15(9-10-22)12-17-6-8-19(24-2)14-21(17)26-4;1-4(2)3/h5-8,13-15,22H,9-12H2,1-4H3;1H2,(H,2,3)/p-1 |
| InChIKey | ODZCOQDMODQTNE-UHFFFAOYSA-M |
| XLogP | 2.24 |
| TPSA | 123.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|