About propanoyl 3-amino-4-methylthiophene-2-carboxylate
propanoyl 3-amino-4-methylthiophene-2-carboxylate (PubChem CID 175393544) has the molecular formula C9H11NO3S
and a molecular weight of 213.26 g/mol. Its IUPAC name is propanoyl 3-amino-4-methylthiophene-2-carboxylate.
Molecular Properties
| Compound Name | propanoyl 3-amino-4-methylthiophene-2-carboxylate |
| PubChem CID | 175393544 |
| Molecular Formula | C9H11NO3S |
| Molecular Weight | 213.26 g/mol |
| Exact Mass | 213.05 |
| IUPAC Name | propanoyl 3-amino-4-methylthiophene-2-carboxylate |
| SMILES | CCC(=O)OC(=O)c1scc(C)c1N |
| InChI | InChI=1S/C9H11NO3S/c1-3-6(11)13-9(12)8-7(10)5(2)4-14-8/h4H,3,10H2,1-2H3 |
| InChIKey | FYQYULBYVAFALG-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.26 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze propanoyl 3-amino-4-methylthiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propanoyl 3-amino-4-methylthiophene-2-carboxylate?
The IUPAC name of propanoyl 3-amino-4-methylthiophene-2-carboxylate (CID 175393544) is propanoyl 3-amino-4-methylthiophene-2-carboxylate.
What is the SMILES notation for propanoyl 3-amino-4-methylthiophene-2-carboxylate?
The canonical SMILES for propanoyl 3-amino-4-methylthiophene-2-carboxylate is CCC(=O)OC(=O)c1scc(C)c1N.
What is the InChIKey of propanoyl 3-amino-4-methylthiophene-2-carboxylate?
The InChIKey is FYQYULBYVAFALG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO3S/c1-3-6(11)13-9(12)8-7(10)5(2)4-14-8/h4H,3,10H2,1-2H3.
What are the key properties of propanoyl 3-amino-4-methylthiophene-2-carboxylate?
propanoyl 3-amino-4-methylthiophene-2-carboxylate has a molecular weight of 213.26 g/mol, XLogP of 1.73, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propanoyl 3-amino-4-methylthiophene-2-carboxylate is sourced from PubChem (CID 175393544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).