methyl 3-amino-4-chlorothiophene-2-carboxylate

C6H6ClNO2S — CID 22139844

IUPACmethyl 3-amino-4-chlorothiophene-2-carboxylate
SMILESCOC(=O)c1scc(Cl)c1N
InChIInChI=1S/C6H6ClNO2S/c1-10-6(9)5-4(8)3(7)2-11-5/h2H,8H2,1H3
InChIKeyUGZKUKBGCABYDB-UHFFFAOYSA-N
MW191.64 g/mol
LogP1.77
Rot. Bonds1

About methyl 3-amino-4-chlorothiophene-2-carboxylate

methyl 3-amino-4-chlorothiophene-2-carboxylate (PubChem CID 22139844) has the molecular formula C6H6ClNO2S and a molecular weight of 191.64 g/mol. Its IUPAC name is methyl 3-amino-4-chlorothiophene-2-carboxylate.

Molecular Properties

Compound Namemethyl 3-amino-4-chlorothiophene-2-carboxylate
PubChem CID22139844
Molecular FormulaC6H6ClNO2S
Molecular Weight191.64 g/mol
Exact Mass190.98
IUPAC Namemethyl 3-amino-4-chlorothiophene-2-carboxylate
SMILESCOC(=O)c1scc(Cl)c1N
InChIInChI=1S/C6H6ClNO2S/c1-10-6(9)5-4(8)3(7)2-11-5/h2H,8H2,1H3
InChIKeyUGZKUKBGCABYDB-UHFFFAOYSA-N
XLogP1.77
TPSA52.32 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500191.64
LogP ≤ 51.77
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 3-amino-4-chlorothiophene-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-amino-4-chlorothiophene-2-carboxylate?
The IUPAC name of methyl 3-amino-4-chlorothiophene-2-carboxylate (CID 22139844) is methyl 3-amino-4-chlorothiophene-2-carboxylate.
What is the SMILES notation for methyl 3-amino-4-chlorothiophene-2-carboxylate?
The canonical SMILES for methyl 3-amino-4-chlorothiophene-2-carboxylate is COC(=O)c1scc(Cl)c1N.
What is the InChIKey of methyl 3-amino-4-chlorothiophene-2-carboxylate?
The InChIKey is UGZKUKBGCABYDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6ClNO2S/c1-10-6(9)5-4(8)3(7)2-11-5/h2H,8H2,1H3.
What are the key properties of methyl 3-amino-4-chlorothiophene-2-carboxylate?
methyl 3-amino-4-chlorothiophene-2-carboxylate has a molecular weight of 191.64 g/mol, XLogP of 1.77, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-amino-4-chlorothiophene-2-carboxylate is sourced from PubChem (CID 22139844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).