About methyl 3-amino-4-(2,5-dimethylphenyl)thiophene-2-carboxylate
methyl 3-amino-4-(2,5-dimethylphenyl)thiophene-2-carboxylate (PubChem CID 83971378) has the molecular formula C14H15NO2S
and a molecular weight of 261.35 g/mol. Its IUPAC name is methyl 3-amino-4-(2,5-dimethylphenyl)thiophene-2-carboxylate.
Analyze methyl 3-amino-4-(2,5-dimethylphenyl)thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-amino-4-(2,5-dimethylphenyl)thiophene-2-carboxylate?
The IUPAC name of methyl 3-amino-4-(2,5-dimethylphenyl)thiophene-2-carboxylate (CID 83971378) is methyl 3-amino-4-(2,5-dimethylphenyl)thiophene-2-carboxylate.
What is the SMILES notation for methyl 3-amino-4-(2,5-dimethylphenyl)thiophene-2-carboxylate?
The canonical SMILES for methyl 3-amino-4-(2,5-dimethylphenyl)thiophene-2-carboxylate is COC(=O)c1scc(-c2cc(C)ccc2C)c1N.
What is the InChIKey of methyl 3-amino-4-(2,5-dimethylphenyl)thiophene-2-carboxylate?
The InChIKey is WOMPTHVLMQDOST-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO2S/c1-8-4-5-9(2)10(6-8)11-7-18-13(12(11)15)14(16)17-3/h4-7H,15H2,1-3H3.
What are the key properties of methyl 3-amino-4-(2,5-dimethylphenyl)thiophene-2-carboxylate?
methyl 3-amino-4-(2,5-dimethylphenyl)thiophene-2-carboxylate has a molecular weight of 261.35 g/mol, XLogP of 3.40, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-amino-4-(2,5-dimethylphenyl)thiophene-2-carboxylate is sourced from PubChem (CID 83971378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).