About 3-amino-4-methylthiophene-2-carboxamide;3-amino-4-methylthiophene-2-carboxylic acid
3-amino-4-methylthiophene-2-carboxamide;3-amino-4-methylthiophene-2-carboxylic acid (PubChem CID 159779125) has the molecular formula C12H15N3O3S2
and a molecular weight of 313.40 g/mol. Its IUPAC name is 3-amino-4-methylthiophene-2-carboxamide;3-amino-4-methylthiophene-2-carboxylic acid.
Molecular Properties
| Compound Name | 3-amino-4-methylthiophene-2-carboxamide;3-amino-4-methylthiophene-2-carboxylic acid |
| PubChem CID | 159779125 |
| Molecular Formula | C12H15N3O3S2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | 3-amino-4-methylthiophene-2-carboxamide;3-amino-4-methylthiophene-2-carboxylic acid |
| SMILES | Cc1csc(C(=O)O)c1N.Cc1csc(C(N)=O)c1N |
| InChI | InChI=1S/C6H8N2OS.C6H7NO2S/c2*1-3-2-10-5(4(3)7)6(8)9/h2H,7H2,1H3,(H2,8,9);2H,7H2,1H3,(H,8,9) |
| InChIKey | NHDACDFAPVGLDC-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 132.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-amino-4-methylthiophene-2-carboxamide;3-amino-4-methylthiophene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-4-methylthiophene-2-carboxamide;3-amino-4-methylthiophene-2-carboxylic acid?
The IUPAC name of 3-amino-4-methylthiophene-2-carboxamide;3-amino-4-methylthiophene-2-carboxylic acid (CID 159779125) is 3-amino-4-methylthiophene-2-carboxamide;3-amino-4-methylthiophene-2-carboxylic acid.
What is the SMILES notation for 3-amino-4-methylthiophene-2-carboxamide;3-amino-4-methylthiophene-2-carboxylic acid?
The canonical SMILES for 3-amino-4-methylthiophene-2-carboxamide;3-amino-4-methylthiophene-2-carboxylic acid is Cc1csc(C(=O)O)c1N.Cc1csc(C(N)=O)c1N.
What is the InChIKey of 3-amino-4-methylthiophene-2-carboxamide;3-amino-4-methylthiophene-2-carboxylic acid?
The InChIKey is NHDACDFAPVGLDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2OS.C6H7NO2S/c2*1-3-2-10-5(4(3)7)6(8)9/h2H,7H2,1H3,(H2,8,9);2H,7H2,1H3,(H,8,9).
What are the key properties of 3-amino-4-methylthiophene-2-carboxamide;3-amino-4-methylthiophene-2-carboxylic acid?
3-amino-4-methylthiophene-2-carboxamide;3-amino-4-methylthiophene-2-carboxylic acid has a molecular weight of 313.40 g/mol, XLogP of 2.07, 2 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4-methylthiophene-2-carboxamide;3-amino-4-methylthiophene-2-carboxylic acid is sourced from PubChem (CID 159779125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).