C24H28N6O2 — CID 175397767
tert-butyl 4-[9-[1-(4-ethynylphenyl)ethyl]purin-6-yl]piperazine-1-carboxylate (PubChem CID 175397767) has the molecular formula C24H28N6O2 and a molecular weight of 432.53 g/mol. Its IUPAC name is tert-butyl 4-[9-[1-(4-ethynylphenyl)ethyl]purin-6-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[9-[1-(4-ethynylphenyl)ethyl]purin-6-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 175397767 |
| Molecular Formula | C24H28N6O2 |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | tert-butyl 4-[9-[1-(4-ethynylphenyl)ethyl]purin-6-yl]piperazine-1-carboxylate |
| SMILES | C#Cc1ccc(C(C)n2cnc3c(N4CCN(C(=O)OC(C)(C)C)CC4)ncnc32)cc1 |
| InChI | InChI=1S/C24H28N6O2/c1-6-18-7-9-19(10-8-18)17(2)30-16-27-20-21(25-15-26-22(20)30)28-11-13-29(14-12-28)23(31)32-24(3,4)5/h1,7-10,15-17H,11-14H2,2-5H3 |
| InChIKey | IALPXKHJXCVSLY-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 76.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|