About 6-(2-aminophenyl)-2,3-diethoxyaniline
6-(2-aminophenyl)-2,3-diethoxyaniline (PubChem CID 175397921) has the molecular formula C16H20N2O2
and a molecular weight of 272.35 g/mol. Its IUPAC name is 6-(2-aminophenyl)-2,3-diethoxyaniline.
Molecular Properties
| Compound Name | 6-(2-aminophenyl)-2,3-diethoxyaniline |
| PubChem CID | 175397921 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 6-(2-aminophenyl)-2,3-diethoxyaniline |
| SMILES | CCOc1ccc(-c2ccccc2N)c(N)c1OCC |
| InChI | InChI=1S/C16H20N2O2/c1-3-19-14-10-9-12(15(18)16(14)20-4-2)11-7-5-6-8-13(11)17/h5-10H,3-4,17-18H2,1-2H3 |
| InChIKey | DUHJAPOAKKNAQT-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6-(2-aminophenyl)-2,3-diethoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-aminophenyl)-2,3-diethoxyaniline?
The IUPAC name of 6-(2-aminophenyl)-2,3-diethoxyaniline (CID 175397921) is 6-(2-aminophenyl)-2,3-diethoxyaniline.
What is the SMILES notation for 6-(2-aminophenyl)-2,3-diethoxyaniline?
The canonical SMILES for 6-(2-aminophenyl)-2,3-diethoxyaniline is CCOc1ccc(-c2ccccc2N)c(N)c1OCC.
What is the InChIKey of 6-(2-aminophenyl)-2,3-diethoxyaniline?
The InChIKey is DUHJAPOAKKNAQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2O2/c1-3-19-14-10-9-12(15(18)16(14)20-4-2)11-7-5-6-8-13(11)17/h5-10H,3-4,17-18H2,1-2H3.
What are the key properties of 6-(2-aminophenyl)-2,3-diethoxyaniline?
6-(2-aminophenyl)-2,3-diethoxyaniline has a molecular weight of 272.35 g/mol, XLogP of 3.32, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-aminophenyl)-2,3-diethoxyaniline is sourced from PubChem (CID 175397921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).