C16H20N2O2 — CID 175397921
6-(2-aminophenyl)-2,3-diethoxyaniline (PubChem CID 175397921) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 6-(2-aminophenyl)-2,3-diethoxyaniline.
| Compound Name | 6-(2-aminophenyl)-2,3-diethoxyaniline |
|---|---|
| PubChem CID | 175397921 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 6-(2-aminophenyl)-2,3-diethoxyaniline |
| SMILES | CCOc1ccc(-c2ccccc2N)c(N)c1OCC |
| InChI | InChI=1S/C16H20N2O2/c1-3-19-14-10-9-12(15(18)16(14)20-4-2)11-7-5-6-8-13(11)17/h5-10H,3-4,17-18H2,1-2H3 |
| InChIKey | DUHJAPOAKKNAQT-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|