C26H22F6O4 — CID 175398131
2,3,3,4,5,5-hexafluoro-2,4,6-tris(4-methoxyphenyl)oxane (PubChem CID 175398131) has the molecular formula C26H22F6O4 and a molecular weight of 512.45 g/mol. Its IUPAC name is 2,3,3,4,5,5-hexafluoro-2,4,6-tris(4-methoxyphenyl)oxane.
| Compound Name | 2,3,3,4,5,5-hexafluoro-2,4,6-tris(4-methoxyphenyl)oxane |
|---|---|
| PubChem CID | 175398131 |
| Molecular Formula | C26H22F6O4 |
| Molecular Weight | 512.45 g/mol |
| Exact Mass | 512.14 |
| IUPAC Name | 2,3,3,4,5,5-hexafluoro-2,4,6-tris(4-methoxyphenyl)oxane |
| SMILES | COc1ccc(C2OC(F)(c3ccc(OC)cc3)C(F)(F)C(F)(c3ccc(OC)cc3)C2(F)F)cc1 |
| InChI | InChI=1S/C26H22F6O4/c1-33-19-10-4-16(5-11-19)22-24(28,29)23(27,17-6-12-20(34-2)13-7-17)26(31,32)25(30,36-22)18-8-14-21(35-3)15-9-18/h4-15,22H,1-3H3 |
| InChIKey | IXIRSASDHVJGOF-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.45 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |