C21H25NO4S — CID 177451825
methyl (2Z,2S,3R)-N-tert-butylsulfinyl-3-(4-methoxyphenyl)-2-phenyloxirane-2-carboximidate (PubChem CID 177451825) has the molecular formula C21H25NO4S and a molecular weight of 387.50 g/mol. Its IUPAC name is methyl (2Z,2S,3R)-N-tert-butylsulfinyl-3-(4-methoxyphenyl)-2-phenyloxirane-2-carboximidate.
| Compound Name | methyl (2Z,2S,3R)-N-tert-butylsulfinyl-3-(4-methoxyphenyl)-2-phenyloxirane-2-carboximidate |
|---|---|
| PubChem CID | 177451825 |
| Molecular Formula | C21H25NO4S |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | methyl (2Z,2S,3R)-N-tert-butylsulfinyl-3-(4-methoxyphenyl)-2-phenyloxirane-2-carboximidate |
| SMILES | CO/C(=N\S(=O)C(C)(C)C)[C@@]1(c2ccccc2)O[C@@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C21H25NO4S/c1-20(2,3)27(23)22-19(25-5)21(16-9-7-6-8-10-16)18(26-21)15-11-13-17(24-4)14-12-15/h6-14,18H,1-5H3/b22-19-/t18-,21+,27?/m1/s1 |
| InChIKey | BIYQLHDVQLPEPB-WNCZTTGASA-N |
| XLogP | 4.17 |
| TPSA | 60.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|