C32H25FN2O5 — CID 175398584
2-[3-[1-(4-fluorophenyl)-4-phenylmethoxyindol-2-yl]cyclobutyl]-4-nitrobenzoic acid (PubChem CID 175398584) has the molecular formula C32H25FN2O5 and a molecular weight of 536.56 g/mol. Its IUPAC name is 2-[3-[1-(4-fluorophenyl)-4-phenylmethoxyindol-2-yl]cyclobutyl]-4-nitrobenzoic acid.
| Compound Name | 2-[3-[1-(4-fluorophenyl)-4-phenylmethoxyindol-2-yl]cyclobutyl]-4-nitrobenzoic acid |
|---|---|
| PubChem CID | 175398584 |
| Molecular Formula | C32H25FN2O5 |
| Molecular Weight | 536.56 g/mol |
| Exact Mass | 536.17 |
| IUPAC Name | 2-[3-[1-(4-fluorophenyl)-4-phenylmethoxyindol-2-yl]cyclobutyl]-4-nitrobenzoic acid |
| SMILES | O=C(O)c1ccc([N+](=O)[O-])cc1C1CC(c2cc3c(OCc4ccccc4)cccc3n2-c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C32H25FN2O5/c33-23-9-11-24(12-10-23)34-29-7-4-8-31(40-19-20-5-2-1-3-6-20)28(29)18-30(34)22-15-21(16-22)27-17-25(35(38)39)13-14-26(27)32(36)37/h1-14,17-18,21-22H,15-16,19H2,(H,36,37) |
| InChIKey | UQZCPEHOHMAGTK-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.56 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|