C24H29NO6 — CID 130238229
4-nitro-2-[(3S,5R)-5-[(1R)-1-phenylmethoxyhexyl]oxolan-3-yl]benzoic acid (PubChem CID 130238229) has the molecular formula C24H29NO6 and a molecular weight of 427.50 g/mol. Its IUPAC name is 4-nitro-2-[(3S,5R)-5-[(1R)-1-phenylmethoxyhexyl]oxolan-3-yl]benzoic acid.
| Compound Name | 4-nitro-2-[(3S,5R)-5-[(1R)-1-phenylmethoxyhexyl]oxolan-3-yl]benzoic acid |
|---|---|
| PubChem CID | 130238229 |
| Molecular Formula | C24H29NO6 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | 4-nitro-2-[(3S,5R)-5-[(1R)-1-phenylmethoxyhexyl]oxolan-3-yl]benzoic acid |
| SMILES | CCCCC[C@@H](OCc1ccccc1)[C@H]1C[C@@H](c2cc([N+](=O)[O-])ccc2C(=O)O)CO1 |
| InChI | InChI=1S/C24H29NO6/c1-2-3-5-10-22(30-15-17-8-6-4-7-9-17)23-13-18(16-31-23)21-14-19(25(28)29)11-12-20(21)24(26)27/h4,6-9,11-12,14,18,22-23H,2-3,5,10,13,15-16H2,1H3,(H,26,27)/t18-,22-,23-/m1/s1 |
| InChIKey | ORAWVJLAXUEKEC-SXSPYAJSSA-N |
| XLogP | 5.33 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|