About butan-2-yl-(2,3-dimethoxyphenyl)diazene
butan-2-yl-(2,3-dimethoxyphenyl)diazene (PubChem CID 175398885) has the molecular formula C12H18N2O2
and a molecular weight of 222.29 g/mol. Its IUPAC name is butan-2-yl-(2,3-dimethoxyphenyl)diazene.
Molecular Properties
| Compound Name | butan-2-yl-(2,3-dimethoxyphenyl)diazene |
| PubChem CID | 175398885 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | butan-2-yl-(2,3-dimethoxyphenyl)diazene |
| SMILES | CCC(C)/N=N/c1cccc(OC)c1OC |
| InChI | InChI=1S/C12H18N2O2/c1-5-9(2)13-14-10-7-6-8-11(15-3)12(10)16-4/h6-9H,5H2,1-4H3/b14-13+ |
| InChIKey | UDSPKCDVKJHDGX-BUHFOSPRSA-N |
| XLogP | 3.59 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze butan-2-yl-(2,3-dimethoxyphenyl)diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-yl-(2,3-dimethoxyphenyl)diazene?
The IUPAC name of butan-2-yl-(2,3-dimethoxyphenyl)diazene (CID 175398885) is butan-2-yl-(2,3-dimethoxyphenyl)diazene.
What is the SMILES notation for butan-2-yl-(2,3-dimethoxyphenyl)diazene?
The canonical SMILES for butan-2-yl-(2,3-dimethoxyphenyl)diazene is CCC(C)/N=N/c1cccc(OC)c1OC.
What is the InChIKey of butan-2-yl-(2,3-dimethoxyphenyl)diazene?
The InChIKey is UDSPKCDVKJHDGX-BUHFOSPRSA-N. The full InChI is InChI=1S/C12H18N2O2/c1-5-9(2)13-14-10-7-6-8-11(15-3)12(10)16-4/h6-9H,5H2,1-4H3/b14-13+.
What are the key properties of butan-2-yl-(2,3-dimethoxyphenyl)diazene?
butan-2-yl-(2,3-dimethoxyphenyl)diazene has a molecular weight of 222.29 g/mol, XLogP of 3.59, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-yl-(2,3-dimethoxyphenyl)diazene is sourced from PubChem (CID 175398885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).