C16H12N4O2 — CID 175402175
3,5-dimethyl-2-(5-nitro-1H-pyrrolo[2,3-b]pyridin-2-yl)benzonitrile (PubChem CID 175402175) has the molecular formula C16H12N4O2 and a molecular weight of 292.30 g/mol. Its IUPAC name is 3,5-dimethyl-2-(5-nitro-1H-pyrrolo[2,3-b]pyridin-2-yl)benzonitrile.
| Compound Name | 3,5-dimethyl-2-(5-nitro-1H-pyrrolo[2,3-b]pyridin-2-yl)benzonitrile |
|---|---|
| PubChem CID | 175402175 |
| Molecular Formula | C16H12N4O2 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 3,5-dimethyl-2-(5-nitro-1H-pyrrolo[2,3-b]pyridin-2-yl)benzonitrile |
| SMILES | Cc1cc(C)c(-c2cc3cc([N+](=O)[O-])cnc3[nH]2)c(C#N)c1 |
| InChI | InChI=1S/C16H12N4O2/c1-9-3-10(2)15(12(4-9)7-17)14-6-11-5-13(20(21)22)8-18-16(11)19-14/h3-6,8H,1-2H3,(H,18,19) |
| InChIKey | MYHCTBPYFHXADM-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 95.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|