C21H19F4N3O — CID 175402242
2-fluoro-1-[3-methyl-3-[3-[4-(trifluoromethyl)phenyl]-2H-benzimidazol-1-yl]azetidin-1-yl]prop-2-en-1-one (PubChem CID 175402242) has the molecular formula C21H19F4N3O and a molecular weight of 405.40 g/mol. Its IUPAC name is 2-fluoro-1-[3-methyl-3-[3-[4-(trifluoromethyl)phenyl]-2H-benzimidazol-1-yl]azetidin-1-yl]prop-2-en-1-one.
| Compound Name | 2-fluoro-1-[3-methyl-3-[3-[4-(trifluoromethyl)phenyl]-2H-benzimidazol-1-yl]azetidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 175402242 |
| Molecular Formula | C21H19F4N3O |
| Molecular Weight | 405.40 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 2-fluoro-1-[3-methyl-3-[3-[4-(trifluoromethyl)phenyl]-2H-benzimidazol-1-yl]azetidin-1-yl]prop-2-en-1-one |
| SMILES | C=C(F)C(=O)N1CC(C)(N2CN(c3ccc(C(F)(F)F)cc3)c3ccccc32)C1 |
| InChI | InChI=1S/C21H19F4N3O/c1-14(22)19(29)26-11-20(2,12-26)28-13-27(17-5-3-4-6-18(17)28)16-9-7-15(8-10-16)21(23,24)25/h3-10H,1,11-13H2,2H3 |
| InChIKey | MRGSNNQOLOESGA-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.40 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|