C20H32N2O2 — CID 175404109
tert-butyl 2-(2-heptan-2-yl-3-pyridinyl)azetidine-1-carboxylate (PubChem CID 175404109) has the molecular formula C20H32N2O2 and a molecular weight of 332.49 g/mol. Its IUPAC name is tert-butyl 2-(2-heptan-2-yl-3-pyridinyl)azetidine-1-carboxylate.
| Compound Name | tert-butyl 2-(2-heptan-2-yl-3-pyridinyl)azetidine-1-carboxylate |
|---|---|
| PubChem CID | 175404109 |
| Molecular Formula | C20H32N2O2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.25 |
| IUPAC Name | tert-butyl 2-(2-heptan-2-yl-3-pyridinyl)azetidine-1-carboxylate |
| SMILES | CCCCCC(C)c1ncccc1C1CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H32N2O2/c1-6-7-8-10-15(2)18-16(11-9-13-21-18)17-12-14-22(17)19(23)24-20(3,4)5/h9,11,13,15,17H,6-8,10,12,14H2,1-5H3 |
| InChIKey | ZEDKHXQNJKHHRW-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|