C14H20ClNO4 — CID 175407128
[(1R,3R)-1-(2-chlorophenyl)-4-(methoxymethoxy)-3-methylbutyl] carbamate (PubChem CID 175407128) has the molecular formula C14H20ClNO4 and a molecular weight of 301.77 g/mol. Its IUPAC name is [(1R,3R)-1-(2-chlorophenyl)-4-(methoxymethoxy)-3-methylbutyl] carbamate.
| Compound Name | [(1R,3R)-1-(2-chlorophenyl)-4-(methoxymethoxy)-3-methylbutyl] carbamate |
|---|---|
| PubChem CID | 175407128 |
| Molecular Formula | C14H20ClNO4 |
| Molecular Weight | 301.77 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | [(1R,3R)-1-(2-chlorophenyl)-4-(methoxymethoxy)-3-methylbutyl] carbamate |
| SMILES | COCOC[C@H](C)C[C@@H](OC(N)=O)c1ccccc1Cl |
| InChI | InChI=1S/C14H20ClNO4/c1-10(8-19-9-18-2)7-13(20-14(16)17)11-5-3-4-6-12(11)15/h3-6,10,13H,7-9H2,1-2H3,(H2,16,17)/t10-,13-/m1/s1 |
| InChIKey | KMHAWRBJWJIZFJ-ZWNOBZJWSA-N |
| XLogP | 3.12 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.77 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|