About (2-fluoroacetyl) 2-fluoroacetate;prop-2-enoic acid
(2-fluoroacetyl) 2-fluoroacetate;prop-2-enoic acid (PubChem CID 175408800) has the molecular formula C7H8F2O5
and a molecular weight of 210.13 g/mol. Its IUPAC name is (2-fluoroacetyl) 2-fluoroacetate;prop-2-enoic acid.
Molecular Properties
| Compound Name | (2-fluoroacetyl) 2-fluoroacetate;prop-2-enoic acid |
| PubChem CID | 175408800 |
| Molecular Formula | C7H8F2O5 |
| Molecular Weight | 210.13 g/mol |
| Exact Mass | 210.03 |
| IUPAC Name | (2-fluoroacetyl) 2-fluoroacetate;prop-2-enoic acid |
| SMILES | C=CC(=O)O.O=C(CF)OC(=O)CF |
| InChI | InChI=1S/C4H4F2O3.C3H4O2/c5-1-3(7)9-4(8)2-6;1-2-3(4)5/h1-2H2;2H,1H2,(H,4,5) |
| InChIKey | YLBURIREHINBND-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.13 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2-fluoroacetyl) 2-fluoroacetate;prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-fluoroacetyl) 2-fluoroacetate;prop-2-enoic acid?
The IUPAC name of (2-fluoroacetyl) 2-fluoroacetate;prop-2-enoic acid (CID 175408800) is (2-fluoroacetyl) 2-fluoroacetate;prop-2-enoic acid.
What is the SMILES notation for (2-fluoroacetyl) 2-fluoroacetate;prop-2-enoic acid?
The canonical SMILES for (2-fluoroacetyl) 2-fluoroacetate;prop-2-enoic acid is C=CC(=O)O.O=C(CF)OC(=O)CF.
What is the InChIKey of (2-fluoroacetyl) 2-fluoroacetate;prop-2-enoic acid?
The InChIKey is YLBURIREHINBND-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4F2O3.C3H4O2/c5-1-3(7)9-4(8)2-6;1-2-3(4)5/h1-2H2;2H,1H2,(H,4,5).
What are the key properties of (2-fluoroacetyl) 2-fluoroacetate;prop-2-enoic acid?
(2-fluoroacetyl) 2-fluoroacetate;prop-2-enoic acid has a molecular weight of 210.13 g/mol, XLogP of 0.25, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-fluoroacetyl) 2-fluoroacetate;prop-2-enoic acid is sourced from PubChem (CID 175408800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).