C49H98N2O4 — CID 175411573
7-[2-(dimethylamino)ethylamino]-14-hexyl-12-(2-hexyldecoxycarbonyl)docosanoic acid (PubChem CID 175411573) has the molecular formula C49H98N2O4 and a molecular weight of 779.33 g/mol. Its IUPAC name is 7-[2-(dimethylamino)ethylamino]-14-hexyl-12-(2-hexyldecoxycarbonyl)docosanoic acid.
| Compound Name | 7-[2-(dimethylamino)ethylamino]-14-hexyl-12-(2-hexyldecoxycarbonyl)docosanoic acid |
|---|---|
| PubChem CID | 175411573 |
| Molecular Formula | C49H98N2O4 |
| Molecular Weight | 779.33 g/mol |
| Exact Mass | 778.75 |
| IUPAC Name | 7-[2-(dimethylamino)ethylamino]-14-hexyl-12-(2-hexyldecoxycarbonyl)docosanoic acid |
| SMILES | CCCCCCCCC(CCCCCC)COC(=O)C(CCCCC(CCCCCC(=O)O)NCCN(C)C)CC(CCCCCC)CCCCCCCC |
| InChI | InChI=1S/C49H98N2O4/c1-7-11-15-19-21-26-33-44(32-24-17-13-9-3)42-46(36-30-31-38-47(50-40-41-51(5)6)37-28-23-29-39-48(52)53)49(54)55-43-45(34-25-18-14-10-4)35-27-22-20-16-12-8-2/h44-47,50H,7-43H2,1-6H3,(H,52,53) |
| InChIKey | YQMOBDIDNYGQBB-UHFFFAOYSA-N |
| XLogP | 14.33 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.33 |
| LogP ≤ 5 | 14.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|