C21H24ClN3O4 — CID 175415267
(3S)-3-[2-(2-chloro-6-methyl-3-pyridinyl)ethyl]-3-(phenylmethoxycarbonylamino)pyrrolidine-1-carboxylic acid (PubChem CID 175415267) has the molecular formula C21H24ClN3O4 and a molecular weight of 417.89 g/mol. Its IUPAC name is (3S)-3-[2-(2-chloro-6-methyl-3-pyridinyl)ethyl]-3-(phenylmethoxycarbonylamino)pyrrolidine-1-carboxylic acid.
| Compound Name | (3S)-3-[2-(2-chloro-6-methyl-3-pyridinyl)ethyl]-3-(phenylmethoxycarbonylamino)pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 175415267 |
| Molecular Formula | C21H24ClN3O4 |
| Molecular Weight | 417.89 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | (3S)-3-[2-(2-chloro-6-methyl-3-pyridinyl)ethyl]-3-(phenylmethoxycarbonylamino)pyrrolidine-1-carboxylic acid |
| SMILES | Cc1ccc(CC[C@]2(NC(=O)OCc3ccccc3)CCN(C(=O)O)C2)c(Cl)n1 |
| InChI | InChI=1S/C21H24ClN3O4/c1-15-7-8-17(18(22)23-15)9-10-21(11-12-25(14-21)20(27)28)24-19(26)29-13-16-5-3-2-4-6-16/h2-8H,9-14H2,1H3,(H,24,26)(H,27,28)/t21-/m0/s1 |
| InChIKey | GAASSSQKLLATBA-NRFANRHFSA-N |
| XLogP | 4.02 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.89 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|