C15H26 — CID 175423188
cyclohexylcyclohexane;propa-1,2-diene (PubChem CID 175423188) has the molecular formula C15H26 and a molecular weight of 206.37 g/mol. Its IUPAC name is cyclohexylcyclohexane;propa-1,2-diene.
| Compound Name | cyclohexylcyclohexane;propa-1,2-diene |
|---|---|
| PubChem CID | 175423188 |
| Molecular Formula | C15H26 |
| Molecular Weight | 206.37 g/mol |
| Exact Mass | 206.20 |
| IUPAC Name | cyclohexylcyclohexane;propa-1,2-diene |
| SMILES | C1CCC(C2CCCCC2)CC1.C=C=C |
| InChI | InChI=1S/C12H22.C3H4/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-3-2/h11-12H,1-10H2;1-2H2 |
| InChIKey | VAYFMXGYGGCVID-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.37 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |