C25H25BBrFO4 — CID 175425236
3-bromo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid;1-fluoro-4-phenylbenzene (PubChem CID 175425236) has the molecular formula C25H25BBrFO4 and a molecular weight of 499.19 g/mol. Its IUPAC name is 3-bromo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid;1-fluoro-4-phenylbenzene.
| Compound Name | 3-bromo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid;1-fluoro-4-phenylbenzene |
|---|---|
| PubChem CID | 175425236 |
| Molecular Formula | C25H25BBrFO4 |
| Molecular Weight | 499.19 g/mol |
| Exact Mass | 498.10 |
| IUPAC Name | 3-bromo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid;1-fluoro-4-phenylbenzene |
| SMILES | CC1(C)OB(c2cc(Br)cc(C(=O)O)c2)OC1(C)C.Fc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C13H16BBrO4.C12H9F/c1-12(2)13(3,4)19-14(18-12)9-5-8(11(16)17)6-10(15)7-9;13-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h5-7H,1-4H3,(H,16,17);1-9H |
| InChIKey | ZWEAERINBZNWJH-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.19 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|