C20H21P — CID 175426688
(2-phenanthren-9-ylcyclohexyl)phosphane (PubChem CID 175426688) has the molecular formula C20H21P and a molecular weight of 292.36 g/mol. Its IUPAC name is (2-phenanthren-9-ylcyclohexyl)phosphane.
| Compound Name | (2-phenanthren-9-ylcyclohexyl)phosphane |
|---|---|
| PubChem CID | 175426688 |
| Molecular Formula | C20H21P |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | (2-phenanthren-9-ylcyclohexyl)phosphane |
| SMILES | PC1CCCCC1c1cc2ccccc2c2ccccc12 |
| InChI | InChI=1S/C20H21P/c21-20-12-6-5-11-18(20)19-13-14-7-1-2-8-15(14)16-9-3-4-10-17(16)19/h1-4,7-10,13,18,20H,5-6,11-12,21H2 |
| InChIKey | ZJQBZHBMDCQBIC-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|