About 6-(3-amino-2-chloro-6-fluorophenoxy)-5-fluoro-3-methylquinazolin-4-one;tert-butyl carbamate
6-(3-amino-2-chloro-6-fluorophenoxy)-5-fluoro-3-methylquinazolin-4-one;tert-butyl carbamate (PubChem CID 175428858) has the molecular formula C20H21ClF2N4O4
and a molecular weight of 454.86 g/mol. Its IUPAC name is 6-(3-amino-2-chloro-6-fluorophenoxy)-5-fluoro-3-methylquinazolin-4-one;tert-butyl carbamate.
Molecular Properties
| Compound Name | 6-(3-amino-2-chloro-6-fluorophenoxy)-5-fluoro-3-methylquinazolin-4-one;tert-butyl carbamate |
| PubChem CID | 175428858 |
| Molecular Formula | C20H21ClF2N4O4 |
| Molecular Weight | 454.86 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | 6-(3-amino-2-chloro-6-fluorophenoxy)-5-fluoro-3-methylquinazolin-4-one;tert-butyl carbamate |
| SMILES | CC(C)(C)OC(N)=O.Cn1cnc2ccc(Oc3c(F)ccc(N)c3Cl)c(F)c2c1=O |
| InChI | InChI=1S/C15H10ClF2N3O2.C5H11NO2/c1-21-6-20-9-4-5-10(13(18)11(9)15(21)22)23-14-7(17)2-3-8(19)12(14)16;1-5(2,3)8-4(6)7/h2-6H,19H2,1H3;1-3H3,(H2,6,7) |
| InChIKey | BSINPZHKDQGGOA-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 122.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 454.86 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6-(3-amino-2-chloro-6-fluorophenoxy)-5-fluoro-3-methylquinazolin-4-one;tert-butyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-amino-2-chloro-6-fluorophenoxy)-5-fluoro-3-methylquinazolin-4-one;tert-butyl carbamate?
The IUPAC name of 6-(3-amino-2-chloro-6-fluorophenoxy)-5-fluoro-3-methylquinazolin-4-one;tert-butyl carbamate (CID 175428858) is 6-(3-amino-2-chloro-6-fluorophenoxy)-5-fluoro-3-methylquinazolin-4-one;tert-butyl carbamate.
What is the SMILES notation for 6-(3-amino-2-chloro-6-fluorophenoxy)-5-fluoro-3-methylquinazolin-4-one;tert-butyl carbamate?
The canonical SMILES for 6-(3-amino-2-chloro-6-fluorophenoxy)-5-fluoro-3-methylquinazolin-4-one;tert-butyl carbamate is CC(C)(C)OC(N)=O.Cn1cnc2ccc(Oc3c(F)ccc(N)c3Cl)c(F)c2c1=O.
What is the InChIKey of 6-(3-amino-2-chloro-6-fluorophenoxy)-5-fluoro-3-methylquinazolin-4-one;tert-butyl carbamate?
The InChIKey is BSINPZHKDQGGOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10ClF2N3O2.C5H11NO2/c1-21-6-20-9-4-5-10(13(18)11(9)15(21)22)23-14-7(17)2-3-8(19)12(14)16;1-5(2,3)8-4(6)7/h2-6H,19H2,1H3;1-3H3,(H2,6,7).
What are the key properties of 6-(3-amino-2-chloro-6-fluorophenoxy)-5-fluoro-3-methylquinazolin-4-one;tert-butyl carbamate?
6-(3-amino-2-chloro-6-fluorophenoxy)-5-fluoro-3-methylquinazolin-4-one;tert-butyl carbamate has a molecular weight of 454.86 g/mol, XLogP of 4.12, 2 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-amino-2-chloro-6-fluorophenoxy)-5-fluoro-3-methylquinazolin-4-one;tert-butyl carbamate is sourced from PubChem (CID 175428858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).