C17H25F4NO2Si — CID 175430034
tert-butyl-[1-[4-(1-ethoxyethenyl)-3-fluoro-2-pyridinyl]-1,2,2-trifluoroethoxy]-dimethylsilane (PubChem CID 175430034) has the molecular formula C17H25F4NO2Si and a molecular weight of 379.47 g/mol. Its IUPAC name is tert-butyl-[1-[4-(1-ethoxyethenyl)-3-fluoro-2-pyridinyl]-1,2,2-trifluoroethoxy]-dimethylsilane.
| Compound Name | tert-butyl-[1-[4-(1-ethoxyethenyl)-3-fluoro-2-pyridinyl]-1,2,2-trifluoroethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 175430034 |
| Molecular Formula | C17H25F4NO2Si |
| Molecular Weight | 379.47 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | tert-butyl-[1-[4-(1-ethoxyethenyl)-3-fluoro-2-pyridinyl]-1,2,2-trifluoroethoxy]-dimethylsilane |
| SMILES | C=C(OCC)c1ccnc(C(F)(O[Si](C)(C)C(C)(C)C)C(F)F)c1F |
| InChI | InChI=1S/C17H25F4NO2Si/c1-8-23-11(2)12-9-10-22-14(13(12)18)17(21,15(19)20)24-25(6,7)16(3,4)5/h9-10,15H,2,8H2,1,3-7H3 |
| InChIKey | NCAODBKNJKLJJL-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.47 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|