C17H32ClNO2Si — CID 175433479
N-[3-[dimethoxy(methyl)silyl]propyl]-3-phenylpentan-3-amine;hydrochloride (PubChem CID 175433479) has the molecular formula C17H32ClNO2Si and a molecular weight of 345.99 g/mol. Its IUPAC name is N-[3-[dimethoxy(methyl)silyl]propyl]-3-phenylpentan-3-amine;hydrochloride.
| Compound Name | N-[3-[dimethoxy(methyl)silyl]propyl]-3-phenylpentan-3-amine;hydrochloride |
|---|---|
| PubChem CID | 175433479 |
| Molecular Formula | C17H32ClNO2Si |
| Molecular Weight | 345.99 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | N-[3-[dimethoxy(methyl)silyl]propyl]-3-phenylpentan-3-amine;hydrochloride |
| SMILES | CCC(CC)(NCCC[Si](C)(OC)OC)c1ccccc1.Cl |
| InChI | InChI=1S/C17H31NO2Si.ClH/c1-6-17(7-2,16-12-9-8-10-13-16)18-14-11-15-21(5,19-3)20-4;/h8-10,12-13,18H,6-7,11,14-15H2,1-5H3;1H |
| InChIKey | OFBRYJKAPXIYCE-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.99 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|